Guided course 01:53Learning Alkane Prefixes up to 12 Carbons in LengthJohnny Betancourt2016views33rank
Guided course 01:43How to determine the direction of the root chainJohnny Betancourt1967views39rank4comments
Guided course 03:07How to identify and locate branches (substituents)Johnny Betancourt1660views23rank
Guided course 02:25Name the longest carbon chain and substituentsJohnny Betancourt1823views28rank7comments
Guided course 07:08Provide the IUPAC name for the following alkaneJohnny Betancourt1646views38rank19comments
Textbook Question1. Without looking at the structures, give molecular formulas for the compounds in Problem-3-8 (a) and (b). (a) 4-(1,1-dimethylethyl)octane (b) 5-(1,2,2-trimethylpropyl)nonane 2. Use the names of the groups to determine the number of carbon atoms; then use the (2n+2) rule.506views
Textbook QuestionAll of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. a. 3-ethyl-4-methylpentane b. 2-ethyl-3-methylpentane c. 3-dimethylhexane642views
Textbook QuestionName the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order. a. CH3CH(CH2CH3)CH2CH3 596views
Textbook QuestionAll of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. a. 3-ethyl-4-methylpentane b. 2-ethyl-3-methylpentane c. 3-dimethylhexane303views
Textbook QuestionDraw the structures of the following compounds. a. 4-(1,1-dimethylethyl)octane2147views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds? a. <S> 1278views
Textbook QuestionProvide IUPAC names for the following compounds. a. (CH3)2CHCH2CH3 b. CH3—C(CH3)2—CH3 c. 3305views
Textbook QuestionGive the IUPAC names of the following alkanes. a. CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2 b.457views
Textbook QuestionName the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order. c. d.288views
Textbook QuestionThe following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly. e. 2-cyclohexylbutane f. 2,3-diethylcyclopentane276views
Textbook QuestionThe following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly. c. 5-chloro-4-methylhexane d. 2-dimethylbutane279views
Textbook QuestionAll of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. d. 4-isobutylheptane e. 2-bromo-3-ethylbutane f. 2,3-diethyl-5-isopropylheptane332views
Textbook QuestionDraw the structures of the following compounds. c. 3,3-diethyl-4-(2,2-dimethylpropyl)octane450views
Textbook QuestionDraw the structures of the following compounds. b. 5-(1,2,2-trimethylpropyl)nonane629views
Textbook QuestionA student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. h. 5-ethyl-2-methylhexane269views
Textbook QuestionA student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. g. 3,3-dichlorooctane260views
Textbook QuestionDraw a condensed structure and a skeletal structure for each of the following: l. 5-isopropyldecane302views
Textbook QuestionDraw a condensed structure and a skeletal structure for each of the following: k. 3,4-dimethyloctane288views
Textbook QuestionDraw skeletal structures for the following: f. 2,6-dimethyl-4-(2-methylpropyl)decane432views
Textbook QuestionDraw skeletal structures for the following: e. 2-methyl-4-(1-methylethyl)octane380views
Textbook QuestionGive the systematic names for all alkanes with molecular formula C7H16 that do not have any secondary hydrogens.273views
Textbook QuestionDraw the structure for each of the following: (e) 2,5-dimethyl-4-(2-methylpropyl)octane298views
Textbook QuestionDraw the structure for each of the following: (d) 2,4,5-trimethyl-4-(1-methylethyl)heptane472views
Textbook QuestionA student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. k. 2-methyl-2-isopropylheptane347views
Textbook QuestionDraw a condensed structure and a skeletal structure for each of the following: g. 4-(1,1-dimethylethyl)heptane264views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (c) 6-ethyl-3-methyloctane289views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (d) 4-butyldecane323views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (b) 1,5-dimethylcyclohexane295views
Textbook QuestionName the following alkanes using the IUPAC system of nomenclature. [Each molecule exemplifies one of the nomenclature rules in Tables 3.7 and 3.8.] (k) rule 6236views
Textbook QuestionName the following alkanes using the IUPAC system of nomenclature. [Each molecule exemplifies one of the nomenclature rules in Tables 3.7 and 3.8.] (n) rule 7390views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (a) 4-methylhexane264views
Textbook QuestionDraw the structure for each of the following: (a) 2,2-dimethyl-4-isopropyloctane322views
Textbook QuestionDraw the structure that corresponds with each name. a. 3-ethyloctane b. 4-isopropyldecane270views
Textbook QuestionDraw the structure for each of the following: (f) 4-(1,1-dimethylethyl)octane240views
Textbook QuestionDraw the structure and give the systematic name for a compound with molecular formula C5H12 that has (c) one tertiary hydrogen438views
Textbook QuestionName the following alkanes using the IUPAC system of nomenclature. [Each molecule exemplifies one of the nomenclature rules in Tables 3.7 and 3.8.](j) rule 5<IMAGE>187views
Textbook Questiona. There are 18 isomeric alkanes of molecular formula C8H18. Draw and name any eight of them.128views
Textbook QuestionFor each molecular formula, draw all the isomeric alkynes, and give their IUPAC names. Circle the acetylenic hydrogen of each terminal alkyne.b. (b) C6H10 (seven isomers)97views
Textbook QuestionUsing the general molecular formula for alkanes:a. Predict the molecular formula of theC28 straight-chain alkane.124views
Textbook QuestionDraw a condensed and a skeletal structure for each of the following: (b) 2,2,5-trimethylhexane352views
Textbook QuestionMake a model of propane (C3H8), and draw this model using dashed lines and wedges to represent bonds going back and coming forward.826views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.](a) 4-methylhexane183views