Guided course 01:53Learning Alkane Prefixes up to 12 Carbons in LengthJohnny Betancourt2860views43rank
Guided course 01:43How to determine the direction of the root chainJohnny Betancourt2785views51rank4comments
Guided course 03:07How to identify and locate branches (substituents)Johnny Betancourt2417views28rank
Guided course 02:25Name the longest carbon chain and substituentsJohnny Betancourt2555views39rank7comments
Guided course 07:08Provide the IUPAC name for the following alkaneJohnny Betancourt2336views58rank19comments
Textbook Question1. Without looking at the structures, give molecular formulas for the compounds in Problem-3-8 (a) and (b). (a) 4-(1,1-dimethylethyl)octane (b) 5-(1,2,2-trimethylpropyl)nonane 2. Use the names of the groups to determine the number of carbon atoms; then use the (2n+2) rule.684views
Textbook QuestionAll of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. a. 3-ethyl-4-methylpentane b. 2-ethyl-3-methylpentane c. 3-dimethylhexane854views
Textbook QuestionName the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order. a. CH3CH(CH2CH3)CH2CH3 859views
Textbook QuestionAll of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. a. 3-ethyl-4-methylpentane b. 2-ethyl-3-methylpentane c. 3-dimethylhexane467views
Textbook QuestionDraw the structures of the following compounds. a. 4-(1,1-dimethylethyl)octane2948views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds? a. <S> 1715views
Textbook QuestionProvide IUPAC names for the following compounds. a. (CH3)2CHCH2CH3 b. CH3—C(CH3)2—CH3 c. 4527views
Textbook QuestionGive the IUPAC names of the following alkanes. a. CH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2 b.779views1rank
Textbook QuestionName the following alkanes and haloalkanes. When two or more substituents are present, list them in alphabetical order. c. d.442views
Textbook QuestionThe following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly. e. 2-cyclohexylbutane f. 2,3-diethylcyclopentane402views
Textbook QuestionThe following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly. c. 5-chloro-4-methylhexane d. 2-dimethylbutane400views
Textbook QuestionAll of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. d. 4-isobutylheptane e. 2-bromo-3-ethylbutane f. 2,3-diethyl-5-isopropylheptane498views
Textbook QuestionDraw the structures of the following compounds. c. 3,3-diethyl-4-(2,2-dimethylpropyl)octane652views
Textbook QuestionDraw the structures of the following compounds. b. 5-(1,2,2-trimethylpropyl)nonane921views
Textbook QuestionA student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. h. 5-ethyl-2-methylhexane402views
Textbook QuestionA student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. g. 3,3-dichlorooctane388views
Textbook QuestionDraw a condensed structure and a skeletal structure for each of the following: l. 5-isopropyldecane520views
Textbook QuestionDraw a condensed structure and a skeletal structure for each of the following: k. 3,4-dimethyloctane456views
Textbook QuestionDraw skeletal structures for the following: f. 2,6-dimethyl-4-(2-methylpropyl)decane669views
Textbook QuestionDraw skeletal structures for the following: e. 2-methyl-4-(1-methylethyl)octane580views
Textbook QuestionGive the systematic names for all alkanes with molecular formula C7H16 that do not have any secondary hydrogens.509views
Textbook QuestionDraw the structure for each of the following: (e) 2,5-dimethyl-4-(2-methylpropyl)octane488views
Textbook QuestionDraw the structure for each of the following: (d) 2,4,5-trimethyl-4-(1-methylethyl)heptane811views
Textbook QuestionA student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. k. 2-methyl-2-isopropylheptane583views
Textbook QuestionDraw a condensed structure and a skeletal structure for each of the following: g. 4-(1,1-dimethylethyl)heptane431views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (c) 6-ethyl-3-methyloctane537views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (d) 4-butyldecane546views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (b) 1,5-dimethylcyclohexane451views
Textbook QuestionName the following alkanes using the IUPAC system of nomenclature. [Each molecule exemplifies one of the nomenclature rules in Tables 3.7 and 3.8.] (k) rule 6374views
Textbook QuestionName the following alkanes using the IUPAC system of nomenclature. [Each molecule exemplifies one of the nomenclature rules in Tables 3.7 and 3.8.] (n) rule 7619views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.] (a) 4-methylhexane429views
Textbook QuestionDraw the structure for each of the following: (a) 2,2-dimethyl-4-isopropyloctane670views
Textbook QuestionDraw the structure that corresponds with each name. a. 3-ethyloctane b. 4-isopropyldecane511views
Textbook QuestionDraw the structure for each of the following: (f) 4-(1,1-dimethylethyl)octane450views
Textbook QuestionDraw the structure and give the systematic name for a compound with molecular formula C5H12 that has (c) one tertiary hydrogen679views
Textbook QuestionName the following alkanes using the IUPAC system of nomenclature. [Each molecule exemplifies one of the nomenclature rules in Tables 3.7 and 3.8.](j) rule 5<IMAGE>403views
Textbook Questiona. There are 18 isomeric alkanes of molecular formula C8H18. Draw and name any eight of them.298views
Textbook QuestionFor each molecular formula, draw all the isomeric alkynes, and give their IUPAC names. Circle the acetylenic hydrogen of each terminal alkyne.b. (b) C6H10 (seven isomers)261views
Textbook QuestionUsing the general molecular formula for alkanes:a. Predict the molecular formula of theC28 straight-chain alkane.279views
Textbook QuestionDraw a condensed and a skeletal structure for each of the following: (b) 2,2,5-trimethylhexane564views
Textbook QuestionMake a model of propane (C3H8), and draw this model using dashed lines and wedges to represent bonds going back and coming forward.1213views
Textbook Question(•••) Correct the following incorrect names using standard IUPAC nomenclature. [Draw a compound that corresponds to the incorrect name, and then rename it.](a) 4-methylhexane350views