Guided course 04:28How to name different types of double bonds or ringsJohnny Betancourt3596views44rank10comments
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. d. cyclopentene, e. CH3CH=C(CH2CH2CH3)CH2CH3 f. CH3CH=NCH3 770views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. a. CH3CH=CHCH3 b. CH3C≡CCH3 c. CH2=C(CH3)2 739views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of those that do. a. CHF=CHF b. F2C=CH3 c. CH2=CHCH2CH3 1276views
Textbook QuestionTwo compounds with the formula CH3CH=NCH3 are known. What two compounds have this formula? Explain why only one compound with the formula (CH3)2CNCH3 is known.1549views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds? b. <S>585views
Textbook QuestionName the following cycloalkanes using the IUPAC system of nomenclature, being sure to indicate whether they are cis or trans. (b)368views
Textbook QuestionAssign relative priorities to each set of substituents: b. -CH2CH2OH, -OH, -CH2Cl, -CH=CH2745views
Textbook QuestionDraw the Z isomer of an alkene that has a CH3 and an H on one sp2 carbon and isopropyl and butyl groups on the other sp2 carbon.1029views
Textbook QuestionTamoxifen slows the growth of some breast tumors by binding to estrogen receptors. Is tamoxifen an E or a Z isomer?766views
Textbook QuestionAssign relative priorities to each set of substituents: a. -Br, -I, -OH, -CH3666views
Textbook Questiona. Which of the following compounds can exist as cis–trans isomers? 1. CH3CH=CHCH2CH2CH3 2. CH3CH=CHCH3 3. CH3CH2C(CH2CH3)=CHCH3 4. CH3CH2CH=CH22891views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: a. b.640views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: c. d.375views
Textbook QuestionAssign relative priorities to each set of substituents: c. -C(=O)CH3, -CH=CH2, -Cl, -C=N382views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: d. 3-methyl-2,4-hexadiene548views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: c. 1,4-pentadiene358views
Textbook QuestionDraw the isomers for the following compounds and then name each one: c. 1,3-pentadiene710views
Textbook QuestionDraw the isomers for the following compounds and then name each one: b. 2,4-heptadiene405views
Textbook QuestionDraw the isomers for the following compounds and then name each one: a. 2-methyl-2,4-hexadiene404views
Textbook QuestionDraw structures for the following: c. (3Z,5Z)-4,5-dimethyl-3,5-nonadiene d. (3E,5E)-2,5-dibromo-3,5-octadiene626views
Textbook QuestionDraw the condensed structure for each of the following:a. (Z)-1,3,5-tribromo-2-penteneb. (Z)-3-methyl-2-heptenec. (E)-1,2-dibromo-3-isopropyl-2-hexene546views
Textbook QuestionFor the compound 1-ethyl-3-isopropylcyclopentane, (a) draw two different cis and two different trans isomers.457views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-diene b. using the E-Z nomenclature.1229views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. c. 3-bromo-2-methylhex-3-ene d. penta-1,3-diene539views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. a. 3-bromo-2-chloropent-2-ene b. 3-ethylhexa-2,4-diene674views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. e. 2,3-dimethylpent-2-ene f. 3,4-dibromocyclopentene691views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. a. hex-3-ene b.buta-1,3-diene958views1rank
Textbook QuestionDetermine which compounds show cis-trans isomerism. Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable. c. hex-3-ene d. 1,1-dibromopropene729views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. i. Cyclodeca-1,5-diene347views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. g. cyclohexene h. cyclodecene412views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. e. 3-ethyl-5-methyloct-3-ene f. 3,7-dichloroocta-2,5-diene433views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. c. hexa-2,4-diene d. 3-methylpent-2-ene431views
Textbook QuestionThe following names are all incorrect. Draw the structure represented by the incorrect name (or a consistent structure if the name is ambiguous), and give your drawing the correct name. a. cis-dimethylpent-2-ene b. 3-vinylhex-4-ene382views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (a)392views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (c)393views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (a) (E)-4-ethyl-5-methyloct-3-ene444views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (c) (Z)-3-isopropylhept-3-ene344views
Textbook QuestionWrite structural formulas for the following compounds (includes both old- and new-style names). (g) 5,5-dibromo-4-phenylcyclooct-1-yne (h) (E)-6-ethyloct-2-en-4-yne (i) 1,4-heptadiyne662views
Textbook QuestionDraw the structures that correspond to the following names. (c) (Z)-2-chloro-7-methyloct-2-en-4-yne359views
Textbook Question(•) Name the following halogenated compounds according to the IUPAC rules of nomenclature. (c)320views
Textbook QuestionGiven the name, draw the structure of the following alkenes.(b) ((Z)-1-cyclohexyl-2-methylhept-2-ene380views
Textbook QuestionDraw the cis and trans isomers for the following: a. 1-bromo-4-chlorocyclohexane996views
Textbook QuestionDisregarding stereoisomers, draw the structures of all alkenes with molecular formula C5H10. Which ones can exist as cis–trans isomers?314views
Textbook Questionα -Farnesene is a dodecatetraene found in the waxy coating of apple skins. What is its systematic name? Include E and Z where necessary to indicate the configuration of the double bonds.<IMAGE>337views
Textbook QuestionImines can exist as stereoisomers. The isomers are named using the E,Z system of nomenclature (Section 4.2 ). The lone pair has the lowest priority. Draw the structure of each of the following compounds: a. the (E)-hydrazone of benzaldehyde b. the (Z)-oxime of propiophenone641views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-dienea. using the cis-trans nomenclature.293views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.a. 3-ethyl-1,1-dimethylcyclohexane281views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.c. 1-ethyl-3-methylcyclopentane326views
Textbook QuestionDraw a structure for each compound (includes old and new names).d. 1,3-cyclohexadienee. cycloocta-1,4-dienef. (Z)-3-methyl-2-octene251views
Textbook QuestionDetermine which compounds show cis-trans isomerism.Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable.a. pent-1-eneb. pent-2-ene243views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.b. 1-ethyl-3-methylcycloheptane255views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.679views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.537views
Textbook Questiona. Draw the condensed structures and give the systematic names for all the alkenes with molecular formula C6H12, ignoring stereoisomers. (Hint: There are 13.) b. Which of the alkenes have E and Z isomers? c. Which of the alkenes is the most stable? d. Which of the alkenes is the least stable?831views1rank
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 1. CH3CH=CHCH2CH2CH3 3. CH3CH2C(CH2CH3)=CHCH3721views
Textbook QuestionDraw the cis and trans isomers for the following: b. 1-ethyl-3-methylcyclobutane966views
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 2. CH3CH=CHCH3 4. CH3CH2CH=CH2701views
Textbook QuestionDraw the structures and give the common and systematic names for the seven alkynes with molecular formula C6H10.556views
Textbook Question1. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. 2. Draw the trans isomer, and circle the coplanar atoms. Are there still six?2379views
Textbook Questiona. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. b. Circle the six coplanar atoms in this compound.464views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds?c. <IMAGES>276views
Textbook QuestionDraw a structure for each compound (includes old and new names).g. vinylcyclopropaneh. (Z)-2-bromo-2-pentene267views
Textbook QuestionDraw a structure for each compound (includes old and new names).i. (3Z,6E)-1,3,6-octatriene331views
Textbook QuestionDraw the structure that corresponds to the name provided. (d) (2R,4Z)-5-bromopent-4-ene-1,2-diol308views
Textbook QuestionDraw the structure that corresponds to the name provided. (b) (2R,3R,4S)-heptane-2,3,4-triol413views
Textbook QuestionDraw the structure that corresponds to the name provided. (a) (1R,5S)-5-methylcyclohex-3-enol346views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: a. 2-methyl-2,4-hexadiene352views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: b. 1,5-heptadiene408views