Guided course 04:28How to name different types of double bonds or ringsJohnny Betancourt3666views44rank10comments
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. d. cyclopentene, e. CH3CH=C(CH2CH2CH3)CH2CH3 f. CH3CH=NCH3 789views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. a. CH3CH=CHCH3 b. CH3C≡CCH3 c. CH2=C(CH3)2 756views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of those that do. a. CHF=CHF b. F2C=CH3 c. CH2=CHCH2CH3 1302views
Textbook QuestionTwo compounds with the formula CH3CH=NCH3 are known. What two compounds have this formula? Explain why only one compound with the formula (CH3)2CNCH3 is known.1594views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds? b. <S>628views
Textbook QuestionName the following cycloalkanes using the IUPAC system of nomenclature, being sure to indicate whether they are cis or trans. (b)379views
Textbook QuestionAssign relative priorities to each set of substituents: b. -CH2CH2OH, -OH, -CH2Cl, -CH=CH2754views
Textbook QuestionDraw the Z isomer of an alkene that has a CH3 and an H on one sp2 carbon and isopropyl and butyl groups on the other sp2 carbon.1044views
Textbook QuestionTamoxifen slows the growth of some breast tumors by binding to estrogen receptors. Is tamoxifen an E or a Z isomer?778views
Textbook QuestionAssign relative priorities to each set of substituents: a. -Br, -I, -OH, -CH3674views
Textbook Questiona. Which of the following compounds can exist as cis–trans isomers? 1. CH3CH=CHCH2CH2CH3 2. CH3CH=CHCH3 3. CH3CH2C(CH2CH3)=CHCH3 4. CH3CH2CH=CH22957views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: a. b.657views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: c. d.382views
Textbook QuestionAssign relative priorities to each set of substituents: c. -C(=O)CH3, -CH=CH2, -Cl, -C=N399views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: d. 3-methyl-2,4-hexadiene574views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: c. 1,4-pentadiene373views
Textbook QuestionDraw the isomers for the following compounds and then name each one: c. 1,3-pentadiene718views
Textbook QuestionDraw the isomers for the following compounds and then name each one: b. 2,4-heptadiene411views
Textbook QuestionDraw the isomers for the following compounds and then name each one: a. 2-methyl-2,4-hexadiene409views
Textbook QuestionDraw structures for the following: c. (3Z,5Z)-4,5-dimethyl-3,5-nonadiene d. (3E,5E)-2,5-dibromo-3,5-octadiene644views
Textbook QuestionDraw the condensed structure for each of the following:a. (Z)-1,3,5-tribromo-2-penteneb. (Z)-3-methyl-2-heptenec. (E)-1,2-dibromo-3-isopropyl-2-hexene560views
Textbook QuestionFor the compound 1-ethyl-3-isopropylcyclopentane, (a) draw two different cis and two different trans isomers.474views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-diene b. using the E-Z nomenclature.1251views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. c. 3-bromo-2-methylhex-3-ene d. penta-1,3-diene571views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. a. 3-bromo-2-chloropent-2-ene b. 3-ethylhexa-2,4-diene692views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. e. 2,3-dimethylpent-2-ene f. 3,4-dibromocyclopentene701views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. a. hex-3-ene b.buta-1,3-diene975views1rank
Textbook QuestionDetermine which compounds show cis-trans isomerism. Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable. c. hex-3-ene d. 1,1-dibromopropene742views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. i. Cyclodeca-1,5-diene372views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. g. cyclohexene h. cyclodecene439views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. e. 3-ethyl-5-methyloct-3-ene f. 3,7-dichloroocta-2,5-diene459views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. c. hexa-2,4-diene d. 3-methylpent-2-ene443views
Textbook QuestionThe following names are all incorrect. Draw the structure represented by the incorrect name (or a consistent structure if the name is ambiguous), and give your drawing the correct name. a. cis-dimethylpent-2-ene b. 3-vinylhex-4-ene401views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (a)400views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (c)405views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (a) (E)-4-ethyl-5-methyloct-3-ene454views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (c) (Z)-3-isopropylhept-3-ene366views
Textbook QuestionWrite structural formulas for the following compounds (includes both old- and new-style names). (g) 5,5-dibromo-4-phenylcyclooct-1-yne (h) (E)-6-ethyloct-2-en-4-yne (i) 1,4-heptadiyne682views
Textbook QuestionDraw the structures that correspond to the following names. (c) (Z)-2-chloro-7-methyloct-2-en-4-yne375views
Textbook Question(•) Name the following halogenated compounds according to the IUPAC rules of nomenclature. (c)328views
Textbook QuestionGiven the name, draw the structure of the following alkenes.(b) ((Z)-1-cyclohexyl-2-methylhept-2-ene397views
Textbook QuestionDraw the cis and trans isomers for the following: a. 1-bromo-4-chlorocyclohexane1030views
Textbook QuestionDisregarding stereoisomers, draw the structures of all alkenes with molecular formula C5H10. Which ones can exist as cis–trans isomers?326views
Textbook Questionα -Farnesene is a dodecatetraene found in the waxy coating of apple skins. What is its systematic name? Include E and Z where necessary to indicate the configuration of the double bonds.<IMAGE>352views
Textbook QuestionImines can exist as stereoisomers. The isomers are named using the E,Z system of nomenclature (Section 4.2 ). The lone pair has the lowest priority. Draw the structure of each of the following compounds: a. the (E)-hydrazone of benzaldehyde b. the (Z)-oxime of propiophenone666views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-dienea. using the cis-trans nomenclature.309views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.a. 3-ethyl-1,1-dimethylcyclohexane307views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.c. 1-ethyl-3-methylcyclopentane356views
Textbook QuestionDraw a structure for each compound (includes old and new names).d. 1,3-cyclohexadienee. cycloocta-1,4-dienef. (Z)-3-methyl-2-octene271views
Textbook QuestionDetermine which compounds show cis-trans isomerism.Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable.a. pent-1-eneb. pent-2-ene256views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.b. 1-ethyl-3-methylcycloheptane285views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.692views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.579views
Textbook Questiona. Draw the condensed structures and give the systematic names for all the alkenes with molecular formula C6H12, ignoring stereoisomers. (Hint: There are 13.) b. Which of the alkenes have E and Z isomers? c. Which of the alkenes is the most stable? d. Which of the alkenes is the least stable?846views1rank
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 1. CH3CH=CHCH2CH2CH3 3. CH3CH2C(CH2CH3)=CHCH3728views
Textbook QuestionDraw the cis and trans isomers for the following: b. 1-ethyl-3-methylcyclobutane990views
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 2. CH3CH=CHCH3 4. CH3CH2CH=CH2711views
Textbook QuestionDraw the structures and give the common and systematic names for the seven alkynes with molecular formula C6H10.576views
Textbook Question1. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. 2. Draw the trans isomer, and circle the coplanar atoms. Are there still six?2452views
Textbook Questiona. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. b. Circle the six coplanar atoms in this compound.489views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds?c. <IMAGES>310views
Textbook QuestionDraw a structure for each compound (includes old and new names).g. vinylcyclopropaneh. (Z)-2-bromo-2-pentene291views
Textbook QuestionDraw a structure for each compound (includes old and new names).i. (3Z,6E)-1,3,6-octatriene347views
Textbook QuestionDraw the structure that corresponds to the name provided. (d) (2R,4Z)-5-bromopent-4-ene-1,2-diol333views
Textbook QuestionDraw the structure that corresponds to the name provided. (b) (2R,3R,4S)-heptane-2,3,4-triol446views
Textbook QuestionDraw the structure that corresponds to the name provided. (a) (1R,5S)-5-methylcyclohex-3-enol362views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: a. 2-methyl-2,4-hexadiene378views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: b. 1,5-heptadiene421views
04:28
