Guided course 04:28How to name different types of double bonds or ringsJohnny Betancourt3633views44rank10comments
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. d. cyclopentene, e. CH3CH=C(CH2CH2CH3)CH2CH3 f. CH3CH=NCH3 778views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. a. CH3CH=CHCH3 b. CH3C≡CCH3 c. CH2=C(CH3)2 752views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of those that do. a. CHF=CHF b. F2C=CH3 c. CH2=CHCH2CH3 1296views
Textbook QuestionTwo compounds with the formula CH3CH=NCH3 are known. What two compounds have this formula? Explain why only one compound with the formula (CH3)2CNCH3 is known.1580views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds? b. <S>611views
Textbook QuestionName the following cycloalkanes using the IUPAC system of nomenclature, being sure to indicate whether they are cis or trans. (b)376views
Textbook QuestionAssign relative priorities to each set of substituents: b. -CH2CH2OH, -OH, -CH2Cl, -CH=CH2753views
Textbook QuestionDraw the Z isomer of an alkene that has a CH3 and an H on one sp2 carbon and isopropyl and butyl groups on the other sp2 carbon.1039views
Textbook QuestionTamoxifen slows the growth of some breast tumors by binding to estrogen receptors. Is tamoxifen an E or a Z isomer?775views
Textbook QuestionAssign relative priorities to each set of substituents: a. -Br, -I, -OH, -CH3672views
Textbook Questiona. Which of the following compounds can exist as cis–trans isomers? 1. CH3CH=CHCH2CH2CH3 2. CH3CH=CHCH3 3. CH3CH2C(CH2CH3)=CHCH3 4. CH3CH2CH=CH22932views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: a. b.654views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: c. d.381views
Textbook QuestionAssign relative priorities to each set of substituents: c. -C(=O)CH3, -CH=CH2, -Cl, -C=N395views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: d. 3-methyl-2,4-hexadiene563views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: c. 1,4-pentadiene371views
Textbook QuestionDraw the isomers for the following compounds and then name each one: c. 1,3-pentadiene716views
Textbook QuestionDraw the isomers for the following compounds and then name each one: b. 2,4-heptadiene410views
Textbook QuestionDraw the isomers for the following compounds and then name each one: a. 2-methyl-2,4-hexadiene407views
Textbook QuestionDraw structures for the following: c. (3Z,5Z)-4,5-dimethyl-3,5-nonadiene d. (3E,5E)-2,5-dibromo-3,5-octadiene637views
Textbook QuestionDraw the condensed structure for each of the following:a. (Z)-1,3,5-tribromo-2-penteneb. (Z)-3-methyl-2-heptenec. (E)-1,2-dibromo-3-isopropyl-2-hexene553views
Textbook QuestionFor the compound 1-ethyl-3-isopropylcyclopentane, (a) draw two different cis and two different trans isomers.467views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-diene b. using the E-Z nomenclature.1242views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. c. 3-bromo-2-methylhex-3-ene d. penta-1,3-diene560views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. a. 3-bromo-2-chloropent-2-ene b. 3-ethylhexa-2,4-diene686views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. e. 2,3-dimethylpent-2-ene f. 3,4-dibromocyclopentene698views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. a. hex-3-ene b.buta-1,3-diene970views1rank
Textbook QuestionDetermine which compounds show cis-trans isomerism. Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable. c. hex-3-ene d. 1,1-dibromopropene738views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. i. Cyclodeca-1,5-diene364views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. g. cyclohexene h. cyclodecene432views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. e. 3-ethyl-5-methyloct-3-ene f. 3,7-dichloroocta-2,5-diene453views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. c. hexa-2,4-diene d. 3-methylpent-2-ene439views
Textbook QuestionThe following names are all incorrect. Draw the structure represented by the incorrect name (or a consistent structure if the name is ambiguous), and give your drawing the correct name. a. cis-dimethylpent-2-ene b. 3-vinylhex-4-ene397views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (a)398views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (c)400views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (a) (E)-4-ethyl-5-methyloct-3-ene451views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (c) (Z)-3-isopropylhept-3-ene361views
Textbook QuestionWrite structural formulas for the following compounds (includes both old- and new-style names). (g) 5,5-dibromo-4-phenylcyclooct-1-yne (h) (E)-6-ethyloct-2-en-4-yne (i) 1,4-heptadiyne676views
Textbook QuestionDraw the structures that correspond to the following names. (c) (Z)-2-chloro-7-methyloct-2-en-4-yne370views
Textbook Question(•) Name the following halogenated compounds according to the IUPAC rules of nomenclature. (c)324views
Textbook QuestionGiven the name, draw the structure of the following alkenes.(b) ((Z)-1-cyclohexyl-2-methylhept-2-ene391views
Textbook QuestionDraw the cis and trans isomers for the following: a. 1-bromo-4-chlorocyclohexane1011views
Textbook QuestionDisregarding stereoisomers, draw the structures of all alkenes with molecular formula C5H10. Which ones can exist as cis–trans isomers?321views
Textbook Questionα -Farnesene is a dodecatetraene found in the waxy coating of apple skins. What is its systematic name? Include E and Z where necessary to indicate the configuration of the double bonds.<IMAGE>345views
Textbook QuestionImines can exist as stereoisomers. The isomers are named using the E,Z system of nomenclature (Section 4.2 ). The lone pair has the lowest priority. Draw the structure of each of the following compounds: a. the (E)-hydrazone of benzaldehyde b. the (Z)-oxime of propiophenone656views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-dienea. using the cis-trans nomenclature.303views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.a. 3-ethyl-1,1-dimethylcyclohexane297views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.c. 1-ethyl-3-methylcyclopentane343views
Textbook QuestionDraw a structure for each compound (includes old and new names).d. 1,3-cyclohexadienee. cycloocta-1,4-dienef. (Z)-3-methyl-2-octene264views
Textbook QuestionDetermine which compounds show cis-trans isomerism.Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable.a. pent-1-eneb. pent-2-ene253views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.b. 1-ethyl-3-methylcycloheptane272views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.688views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.562views
Textbook Questiona. Draw the condensed structures and give the systematic names for all the alkenes with molecular formula C6H12, ignoring stereoisomers. (Hint: There are 13.) b. Which of the alkenes have E and Z isomers? c. Which of the alkenes is the most stable? d. Which of the alkenes is the least stable?841views1rank
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 1. CH3CH=CHCH2CH2CH3 3. CH3CH2C(CH2CH3)=CHCH3725views
Textbook QuestionDraw the cis and trans isomers for the following: b. 1-ethyl-3-methylcyclobutane982views
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 2. CH3CH=CHCH3 4. CH3CH2CH=CH2711views
Textbook QuestionDraw the structures and give the common and systematic names for the seven alkynes with molecular formula C6H10.570views
Textbook Question1. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. 2. Draw the trans isomer, and circle the coplanar atoms. Are there still six?2422views
Textbook Questiona. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. b. Circle the six coplanar atoms in this compound.475views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds?c. <IMAGES>297views
Textbook QuestionDraw a structure for each compound (includes old and new names).g. vinylcyclopropaneh. (Z)-2-bromo-2-pentene285views
Textbook QuestionDraw a structure for each compound (includes old and new names).i. (3Z,6E)-1,3,6-octatriene340views
Textbook QuestionDraw the structure that corresponds to the name provided. (d) (2R,4Z)-5-bromopent-4-ene-1,2-diol325views
Textbook QuestionDraw the structure that corresponds to the name provided. (b) (2R,3R,4S)-heptane-2,3,4-triol435views
Textbook QuestionDraw the structure that corresponds to the name provided. (a) (1R,5S)-5-methylcyclohex-3-enol357views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: a. 2-methyl-2,4-hexadiene371views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: b. 1,5-heptadiene416views