Guided course 04:28How to name different types of double bonds or ringsJohnny Betancourt3645views44rank10comments
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. d. cyclopentene, e. CH3CH=C(CH2CH2CH3)CH2CH3 f. CH3CH=NCH3 779views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of the ones that do. a. CH3CH=CHCH3 b. CH3C≡CCH3 c. CH2=C(CH3)2 752views
Textbook QuestionWhich of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of those that do. a. CHF=CHF b. F2C=CH3 c. CH2=CHCH2CH3 1298views
Textbook QuestionTwo compounds with the formula CH3CH=NCH3 are known. What two compounds have this formula? Explain why only one compound with the formula (CH3)2CNCH3 is known.1584views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds? b. <S>623views
Textbook QuestionName the following cycloalkanes using the IUPAC system of nomenclature, being sure to indicate whether they are cis or trans. (b)377views
Textbook QuestionAssign relative priorities to each set of substituents: b. -CH2CH2OH, -OH, -CH2Cl, -CH=CH2753views
Textbook QuestionDraw the Z isomer of an alkene that has a CH3 and an H on one sp2 carbon and isopropyl and butyl groups on the other sp2 carbon.1042views
Textbook QuestionTamoxifen slows the growth of some breast tumors by binding to estrogen receptors. Is tamoxifen an E or a Z isomer?777views
Textbook QuestionAssign relative priorities to each set of substituents: a. -Br, -I, -OH, -CH3673views
Textbook Questiona. Which of the following compounds can exist as cis–trans isomers? 1. CH3CH=CHCH2CH2CH3 2. CH3CH=CHCH3 3. CH3CH2C(CH2CH3)=CHCH3 4. CH3CH2CH=CH22940views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: a. b.656views
Textbook QuestionAssign relative priorities to the groups or atoms in each of the following sets: c. d.381views
Textbook QuestionAssign relative priorities to each set of substituents: c. -C(=O)CH3, -CH=CH2, -Cl, -C=N397views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: d. 3-methyl-2,4-hexadiene568views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: c. 1,4-pentadiene371views
Textbook QuestionDraw the isomers for the following compounds and then name each one: c. 1,3-pentadiene717views
Textbook QuestionDraw the isomers for the following compounds and then name each one: b. 2,4-heptadiene411views
Textbook QuestionDraw the isomers for the following compounds and then name each one: a. 2-methyl-2,4-hexadiene409views
Textbook QuestionDraw structures for the following: c. (3Z,5Z)-4,5-dimethyl-3,5-nonadiene d. (3E,5E)-2,5-dibromo-3,5-octadiene639views
Textbook QuestionDraw the condensed structure for each of the following:a. (Z)-1,3,5-tribromo-2-penteneb. (Z)-3-methyl-2-heptenec. (E)-1,2-dibromo-3-isopropyl-2-hexene554views
Textbook QuestionFor the compound 1-ethyl-3-isopropylcyclopentane, (a) draw two different cis and two different trans isomers.470views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-diene b. using the E-Z nomenclature.1244views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. c. 3-bromo-2-methylhex-3-ene d. penta-1,3-diene564views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. a. 3-bromo-2-chloropent-2-ene b. 3-ethylhexa-2,4-diene689views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. e. 2,3-dimethylpent-2-ene f. 3,4-dibromocyclopentene699views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. a. hex-3-ene b.buta-1,3-diene972views1rank
Textbook QuestionDetermine which compounds show cis-trans isomerism. Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable. c. hex-3-ene d. 1,1-dibromopropene739views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. i. Cyclodeca-1,5-diene366views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. g. cyclohexene h. cyclodecene433views
Textbook QuestionSome of the following examples can show geometric isomerism, and some cannot. For the ones that can, draw all the geometric isomers, and assign complete names using the E-Z system. e. 3-ethyl-5-methyloct-3-ene f. 3,7-dichloroocta-2,5-diene454views
Textbook QuestionA. Determine which of the following compounds show cis-trans isomerism. B. Draw and name the cis and trans (or Z and E) isomers of those that do. c. hexa-2,4-diene d. 3-methylpent-2-ene440views
Textbook QuestionThe following names are all incorrect. Draw the structure represented by the incorrect name (or a consistent structure if the name is ambiguous), and give your drawing the correct name. a. cis-dimethylpent-2-ene b. 3-vinylhex-4-ene398views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (a)398views
Textbook QuestionName the following alkenes, being sure to specify whether they are cis or trans. (c)400views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (a) (E)-4-ethyl-5-methyloct-3-ene451views
Textbook QuestionGiven the name, draw the structure of the following alkenes. (c) (Z)-3-isopropylhept-3-ene362views
Textbook QuestionWrite structural formulas for the following compounds (includes both old- and new-style names). (g) 5,5-dibromo-4-phenylcyclooct-1-yne (h) (E)-6-ethyloct-2-en-4-yne (i) 1,4-heptadiyne678views
Textbook QuestionDraw the structures that correspond to the following names. (c) (Z)-2-chloro-7-methyloct-2-en-4-yne373views
Textbook Question(•) Name the following halogenated compounds according to the IUPAC rules of nomenclature. (c)324views
Textbook QuestionGiven the name, draw the structure of the following alkenes.(b) ((Z)-1-cyclohexyl-2-methylhept-2-ene394views
Textbook QuestionDraw the cis and trans isomers for the following: a. 1-bromo-4-chlorocyclohexane1020views
Textbook QuestionDisregarding stereoisomers, draw the structures of all alkenes with molecular formula C5H10. Which ones can exist as cis–trans isomers?321views
Textbook Questionα -Farnesene is a dodecatetraene found in the waxy coating of apple skins. What is its systematic name? Include E and Z where necessary to indicate the configuration of the double bonds.<IMAGE>350views
Textbook QuestionImines can exist as stereoisomers. The isomers are named using the E,Z system of nomenclature (Section 4.2 ). The lone pair has the lowest priority. Draw the structure of each of the following compounds: a. the (E)-hydrazone of benzaldehyde b. the (Z)-oxime of propiophenone659views
Textbook QuestionDraw and name all stereoisomers of 3-chlorohepta-2,4-dienea. using the cis-trans nomenclature.307views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.a. 3-ethyl-1,1-dimethylcyclohexane299views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.c. 1-ethyl-3-methylcyclopentane348views
Textbook QuestionDraw a structure for each compound (includes old and new names).d. 1,3-cyclohexadienee. cycloocta-1,4-dienef. (Z)-3-methyl-2-octene266views
Textbook QuestionDetermine which compounds show cis-trans isomerism.Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable.a. pent-1-eneb. pent-2-ene254views
Textbook QuestionWhich of the following cycloalkanes are capable of geometric (cis-trans) isomerism? Draw the cis and trans isomers.b. 1-ethyl-3-methylcycloheptane277views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.690views
Textbook QuestionDraw skeletal structures for the compounds in Problem 3, including any cis–trans isomers.568views
Textbook Questiona. Draw the condensed structures and give the systematic names for all the alkenes with molecular formula C6H12, ignoring stereoisomers. (Hint: There are 13.) b. Which of the alkenes have E and Z isomers? c. Which of the alkenes is the most stable? d. Which of the alkenes is the least stable?844views1rank
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 1. CH3CH=CHCH2CH2CH3 3. CH3CH2C(CH2CH3)=CHCH3725views
Textbook QuestionDraw the cis and trans isomers for the following: b. 1-ethyl-3-methylcyclobutane985views
Textbook Questionb. For those compounds that can exist as cis and trans isomers, draw and label the isomers. 2. CH3CH=CHCH3 4. CH3CH2CH=CH2711views
Textbook QuestionDraw the structures and give the common and systematic names for the seven alkynes with molecular formula C6H10.573views
Textbook Question1. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. 2. Draw the trans isomer, and circle the coplanar atoms. Are there still six?2432views
Textbook Questiona. Draw the structure of cis-CH3CH=CHCH2CH3 showing the pi bond with its proper geometry. b. Circle the six coplanar atoms in this compound.481views
Textbook QuestionWhich of the following structures represent the same compound? Which ones represent different compounds?c. <IMAGES>306views
Textbook QuestionDraw a structure for each compound (includes old and new names).g. vinylcyclopropaneh. (Z)-2-bromo-2-pentene286views
Textbook QuestionDraw a structure for each compound (includes old and new names).i. (3Z,6E)-1,3,6-octatriene342views
Textbook QuestionDraw the structure that corresponds to the name provided. (d) (2R,4Z)-5-bromopent-4-ene-1,2-diol327views
Textbook QuestionDraw the structure that corresponds to the name provided. (b) (2R,3R,4S)-heptane-2,3,4-triol442views
Textbook QuestionDraw the structure that corresponds to the name provided. (a) (1R,5S)-5-methylcyclohex-3-enol359views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: a. 2-methyl-2,4-hexadiene373views
Textbook QuestionFor each of the following compounds, draw the possible geometric isomers and name each isomer: b. 1,5-heptadiene418views