Guided course 01:49Provide the correct common and IUPAC name.Johnny Betancourt2049views29rank14comments
Guided course 00:59Provide the correct common and IUPAC name.Johnny Betancourt1812views27rank11comments
Textbook QuestionPredict which member of each pair has the higher boiling point, and explain the reasons for your predictions. (a) hexan-1-ol or 3,3-dimethylbutan-1-ol (b) hexan-2-one or hexan-2-ol728views
Textbook QuestionPredict which member of each pair will be more soluble in water. Explain the reasons for your answers. (a) hexan-1-ol or cyclohexanol (b) heptan-1-ol or 4-methylphenol (c) 3-ethylhexan-3-ol or octan-2-ol (d) hexan-2-ol or cyclooctane-1,4-diol (e) or 743views
Textbook QuestionDraw the structures of the following compounds. (Includes both new and old names.) (d) 3-cyclopentylhexan-3-ol (e) meso-2,4-pentanediol508views
Textbook QuestionPredict which member of each pair will be more acidic. Explain your answers. (d) 2,2-dichloropropan-1-ol or 2,2-difluoropropan-1-ol426views
Textbook QuestionPredict which member of each pair will be more acidic. Explain your answers. (c) 2-chloroethanol or 2,2-dichloroethanol548views
Textbook QuestionPredict which member of each pair is more acidic, and explain the reasons for your predictions. (b) cyclohexanol or cyclohexanethiol491views
Textbook QuestionPredict which member of each pair is more acidic, and explain the reasons for your predictions. (a) cyclopentanol or 3-chlorophenol458views
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group? (b) NaOH351views
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group? (c) NaCN359views
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group? (e)331views
Textbook Question(•) The following molecules were named incorrectly according to IUPAC nomenclature. Give the correct name of these compounds.(a) 3-oxo-5-methylhexan-2-ol350views
Textbook Question(••) Draw the correct structure from the following IUPAC names:(a) (4R,2Z)-4-methylhex-2-en-1-ol290views
Textbook Question(••) Draw the correct structure from the following IUPAC names:(c) (1S,4R)-4-bromocyclohex-2-en-1-ol312views
Textbook QuestionDraw a condensed structure for each of the following:g. 1-bromo-1-pentyneh. 5-methyl-2-cyclohexenol270views
Textbook QuestionGive a systematic (IUPAC) name for each alcohol. Classify each as primary, secondary, or tertiary.(f) <IMAGE>(g) <IMAGE>291views
Textbook QuestionGive a systematic (IUPAC) name for each diol(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3(b) HO-(CH2)8-OH(c) <IMAGE>503views
Textbook QuestionPredict which member of each group is most soluble in water, and explain the reasons for your predictions.(a) butan-1-ol, pentan-1-ol, or propan-2-ol278views
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group?(d) Et₃N316views
Textbook QuestionWhich of the following bases would favorably deprotonate a hydroxyl group?(a) <IMAGE>292views
Textbook QuestionPropose mechanisms to show the interchange of protons between ethanol molecules under (a) acid catalysis. (b) base catalysis.416views