Organic Chemistry
Improve your experience by picking them
Draw all the isomers of a cyclopentane ring with a molecular formula C 7H14.
Explain why a locant is not required to identify the primary functional group when naming aldehydes.
Draw an example of a γ-keto aldehyde.
Write the IUPAC name for the compound given below.
Name the following compound. Give both an IUPAC and a common name if possible.
Name the carbonyl-containing compound below. If possible, provide both the common and IUPAC names.
CH2(Cl)CH2CH2CH2CH(CH3)CHO
Consider the following compound:
Provide its systematic name, including the configuration of each asymmetric center.
The structure of D-talose is shown below.
Give its systematic name and include the configuration of each asymmetric center.
Draw the corresponding structure for (E)-5-bromopent-4-enal.