Organic Chemistry
Improve your experience by picking them
Convert the condensed formula to the line-angle structures for the following organic compounds.a. (CH3)3CCHOb. CH3COCH2COOH
Show how to draw line-angle structures corresponding to the following condensed formula.(a) CH3CH2CH2CONH2(b) CH3COCH3
Draw a skeletal structure corresponding to each of the following condensed structures.
a. CH3CH2CH(CH3)CH2CH2CH(CH3)2
b. (CH3)3COC(CH3)3
c. (CH3)2CHOH
Draw the non-bonding electron pairs missing from the condensed structures of the following compounds.
(i) CH3CH2CH2NH2
(ii) CH3CH2NHCH2CH3
(iii) CH3CH2CH2OH
Draw the appropriate condensed structure of a hydrocarbon that contains(i) two carbons with sp3 hybridization.(ii) two carbons with sp3 hybridization and two carbons with sp2 hybridization.(iii) three carbons with sp3 hybridization and two carbons with sp hybridization.
What is the skeletal structure of the condensed structure CH3CH2CH2CH2OH?
Provide the skeletal structure for CH3CH2CH2COOH.
From the condensed structure below, draw the equivalent skeletal structure.
Draw the equivalent skeletal structure of CH3CH2CH2N(CH2CH3)2.
What are the condensed structures of the following compounds drawn as models?
(black = C, white = H, red = O, green = Cl)
Provide the mixed condensed structures for the molecules that are represented by the models below. Legend: gray → C, white → H, red → O, and green → N
Show the Lewis structures and condensed formulas of two compounds with the molecular formula C2H6O.
Provide the condensed structures for the following names:
i) vinyl bromide
ii) ethyl acetate
Transform the following structure into a line-angle structural formula.
Convert the given condensed formula into a line-angle structure: (CH3)3CCH2CH2CH2CH(CH3)CH2CHO
Draw the line-angle structure of N-ethyl acetamide using the following structural formula.
Provide the 3-D representation of CCl3F.
Draw the 3-D representation of CHDFCl.
Convert the condensed formula shown below to a line-angle formula.
What are the skeletal structures of CH3CH2CHO and CH3CH2OCH3?
Provide the line-angle structures of the following compounds:
(i) (CH3CH2CH2)2CO
(ii) (CH3CH2CH2)3COH
Draw the bond-line structures of the following compounds:
(i) CH3(CH2)4CH(CH3)2
(ii) (CH3)2CH(CH2)3Br
Provide the line-angle structures for the molecules listed below:
i. HCOCH2CH2CHCHCOOH
ii. CH3COCH2CH(CN)CHO
Write the appropriate line-angle structure for each of the following compounds HOCH2CH2COOH and CH2CHCHCHCOOCH3.
Write the appropriate Lewis structure for each of the following compounds CH3COCHCHCOOH and NCCOCH2CHO. Make sure to include all non-bonding electron pairs in your structures.
Write the appropriate Lewis structures for each of the following species HCHO, CH3C(O)CH3, H2SO3 and HNCO.
Write the appropriate Lewis structures for each of the following species NH2NHCH3, NHNCH3, CH3NH3Cl and CH3CH2CN.
Draw the correct Lewis structure for the molecule CH3CH2CONHCH3.
For the following compound:(i) Draw the appropriate Lewis structure.(ii) Identify the type of orbital used by every carbon to make chemical bonds and estimate the bond angles.
CH3COOH
Write an appropriate Lewis structure for the species CH 3NO2.
Give the Lewis structure of CH3CH2OCH2CH3.
Give the Lewis structure of the given: (CH3)3CCH(CH3)CH2CH(CH3)2
Give the correct Kekulé structures for the following condensed structures:
(i) CH3NH(CH2)2C(CH3)3
(ii) CH3CH(CH3)CH2Cl
Provide the Lewis structures of the molecules listed below:
i. (CH3)3CCH2CH2NO
ii. CH3CH2C(NCH3)CH3
iii. CH3CH2OSO2OCH2CH3
What are the Lewis structures of the condensed formulas below?
(i) CH3CHC(CH3)CHO
(ii) (CH3)2CHCH2COCHCH2